Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1-Butylamine, 99%
CAS: 109-73-9 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.139 MDL Number: MFCD00011690 InChI Key: HQABUPZFAYXKJW-UHFFFAOYSA-N Synonym: butylamine,n-butylamine,1-butanamine,1-aminobutane,1-butylamine,monobutylamine,n-butylamin,mono-n-butylamine,norvalamine,1-aminobutan PubChem CID: 8007 ChEBI: CHEBI:43799 IUPAC Name: butan-1-amine SMILES: CCCCN
| PubChem CID | 8007 |
|---|---|
| CAS | 109-73-9 |
| Molecular Weight (g/mol) | 73.139 |
| ChEBI | CHEBI:43799 |
| MDL Number | MFCD00011690 |
| SMILES | CCCCN |
| Synonym | butylamine,n-butylamine,1-butanamine,1-aminobutane,1-butylamine,monobutylamine,n-butylamin,mono-n-butylamine,norvalamine,1-aminobutan |
| IUPAC Name | butan-1-amine |
| InChI Key | HQABUPZFAYXKJW-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |
2-Chlorothioxanthone, 99%
CAS: 86-39-5 Molecular Formula: C13H7ClOS Molecular Weight (g/mol): 246.71 MDL Number: MFCD00005067 InChI Key: ZCDADJXRUCOCJE-UHFFFAOYSA-N Synonym: 2-chlorothioxanthone,2-chloro-9h-thioxanthen-9-one,9h-thioxanthen-9-one, 2-chloro,unii-rgs87t004b,2-chlorothiaxanthone,2-chlorothioxanthene-9-one,sandoray 1050,2-chloro-thioxanthone,pubchem10692,2-chloro-9-thioxanthone PubChem CID: 618848 IUPAC Name: 2-chloro-9H-thioxanthen-9-one SMILES: ClC1=CC=C2SC3=CC=CC=C3C(=O)C2=C1
| PubChem CID | 618848 |
|---|---|
| CAS | 86-39-5 |
| Molecular Weight (g/mol) | 246.71 |
| MDL Number | MFCD00005067 |
| SMILES | ClC1=CC=C2SC3=CC=CC=C3C(=O)C2=C1 |
| Synonym | 2-chlorothioxanthone,2-chloro-9h-thioxanthen-9-one,9h-thioxanthen-9-one, 2-chloro,unii-rgs87t004b,2-chlorothiaxanthone,2-chlorothioxanthene-9-one,sandoray 1050,2-chloro-thioxanthone,pubchem10692,2-chloro-9-thioxanthone |
| IUPAC Name | 2-chloro-9H-thioxanthen-9-one |
| InChI Key | ZCDADJXRUCOCJE-UHFFFAOYSA-N |
| Molecular Formula | C13H7ClOS |
4-Methylvaleric acid, 99%
CAS: 646-07-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00002803 InChI Key: FGKJLKRYENPLQH-UHFFFAOYSA-N Synonym: 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid PubChem CID: 12587 ChEBI: CHEBI:74903 IUPAC Name: 4-methylpentanoic acid SMILES: CC(C)CCC(=O)O
| PubChem CID | 12587 |
|---|---|
| CAS | 646-07-1 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:74903 |
| MDL Number | MFCD00002803 |
| SMILES | CC(C)CCC(=O)O |
| Synonym | 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid |
| IUPAC Name | 4-methylpentanoic acid |
| InChI Key | FGKJLKRYENPLQH-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Ethyl cinnamate, 98% trans
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.21 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.21 |
| ChEBI | CHEBI:4895 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
Decamethylcyclopentasiloxane, 97%
CAS: 541-02-6 Molecular Formula: C10H30O5Si5 Molecular Weight (g/mol): 370.77 MDL Number: MFCD00046966 InChI Key: XMSXQFUHVRWGNA-UHFFFAOYSA-N Synonym: decamethylcyclopentasiloxane,cyclopentasiloxane, decamethyl,cyclomethicone 5,dimethylsiloxane pentamer,dow corning 345 fluid,nuc silicone vs 7158,dow corning 345,silicon sf 1202,cyclic dimethylsiloxane pentamer,dekamethylcyklopentasiloxan PubChem CID: 10913 IUPAC Name: 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane SMILES: C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
| PubChem CID | 10913 |
|---|---|
| CAS | 541-02-6 |
| Molecular Weight (g/mol) | 370.77 |
| MDL Number | MFCD00046966 |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C |
| Synonym | decamethylcyclopentasiloxane,cyclopentasiloxane, decamethyl,cyclomethicone 5,dimethylsiloxane pentamer,dow corning 345 fluid,nuc silicone vs 7158,dow corning 345,silicon sf 1202,cyclic dimethylsiloxane pentamer,dekamethylcyklopentasiloxan |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| InChI Key | XMSXQFUHVRWGNA-UHFFFAOYSA-N |
| Molecular Formula | C10H30O5Si5 |
Carbon, activated, -20+40 mesh
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12.011 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12.011 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
Glutathione oxidized form 98.0+%, TCI America™
CAS: 27025-41-8 Molecular Formula: C20H32N6O12S2 Molecular Weight (g/mol): 612.63 MDL Number: MFCD00150701 InChI Key: YPZRWBKMTBYPTK-IOKZUGQQNA-N Synonym: oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized PubChem CID: 65359 ChEBI: CHEBI:17858 IUPAC Name: (2S)-2-amino-4-{[(1R)-2-{[(2R)-2-[(4S)-4-amino-4-carboxybutanamido]-2-[(carboxymethyl)carbamoyl]ethyl]disulfanyl}-1-[(carboxymethyl)carbamoyl]ethyl]carbamoyl}butanoic acid SMILES: N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O
| PubChem CID | 65359 |
|---|---|
| CAS | 27025-41-8 |
| Molecular Weight (g/mol) | 612.63 |
| ChEBI | CHEBI:17858 |
| MDL Number | MFCD00150701 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Synonym | oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized |
| IUPAC Name | (2S)-2-amino-4-{[(1R)-2-{[(2R)-2-[(4S)-4-amino-4-carboxybutanamido]-2-[(carboxymethyl)carbamoyl]ethyl]disulfanyl}-1-[(carboxymethyl)carbamoyl]ethyl]carbamoyl}butanoic acid |
| InChI Key | YPZRWBKMTBYPTK-IOKZUGQQNA-N |
| Molecular Formula | C20H32N6O12S2 |
Triphenylphosphine dibromide, 96%
CAS: 1034-39-5 Molecular Formula: C18H15Br2P Molecular Weight (g/mol): 422.10 MDL Number: MFCD00000054 InChI Key: OCXGTPDKNBIOTF-UHFFFAOYSA-N Synonym: dibromotriphenylphosphorane,phosphorane, dibromotriphenyl,triphenyldibromophosphorane,unii-7y0j6r63jd,bromotriphenylphosphonium bromide,dibromotriphenyl-??-phosphane,dibromotriphenylphosphine,dibromtriphenylphosphorane,triphenylphosphinedibromide,dibromo triphenylphosphorane PubChem CID: 70579 IUPAC Name: dibromo(triphenyl)-$l^{5}-phosphane SMILES: BrP(Br)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 70579 |
|---|---|
| CAS | 1034-39-5 |
| Molecular Weight (g/mol) | 422.10 |
| MDL Number | MFCD00000054 |
| SMILES | BrP(Br)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | dibromotriphenylphosphorane,phosphorane, dibromotriphenyl,triphenyldibromophosphorane,unii-7y0j6r63jd,bromotriphenylphosphonium bromide,dibromotriphenyl-??-phosphane,dibromotriphenylphosphine,dibromtriphenylphosphorane,triphenylphosphinedibromide,dibromo triphenylphosphorane |
| IUPAC Name | dibromo(triphenyl)-$l^{5}-phosphane |
| InChI Key | OCXGTPDKNBIOTF-UHFFFAOYSA-N |
| Molecular Formula | C18H15Br2P |
Tetrachloroethylene, Ultrapure, Spectrophotometric Grade, 99+%
CAS: 127-18-4 Molecular Formula: C2Cl4 Molecular Weight (g/mol): 165.82 MDL Number: MFCD00000834 InChI Key: CYTYCFOTNPOANT-UHFFFAOYSA-N Synonym: tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin PubChem CID: 31373 ChEBI: CHEBI:17300 IUPAC Name: 1,1,2,2-tetrachloroethene SMILES: ClC(Cl)=C(Cl)Cl
| PubChem CID | 31373 |
|---|---|
| CAS | 127-18-4 |
| Molecular Weight (g/mol) | 165.82 |
| ChEBI | CHEBI:17300 |
| MDL Number | MFCD00000834 |
| SMILES | ClC(Cl)=C(Cl)Cl |
| Synonym | tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin |
| IUPAC Name | 1,1,2,2-tetrachloroethene |
| InChI Key | CYTYCFOTNPOANT-UHFFFAOYSA-N |
| Molecular Formula | C2Cl4 |
Chloroacetic acid, 99%
CAS: 79-11-8 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.494 MDL Number: MFCD00002683 InChI Key: FOCAUTSVDIKZOP-UHFFFAOYSA-N Synonym: chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure PubChem CID: 300 ChEBI: CHEBI:27869 IUPAC Name: 2-chloroacetic acid SMILES: C(C(=O)O)Cl
| PubChem CID | 300 |
|---|---|
| CAS | 79-11-8 |
| Molecular Weight (g/mol) | 94.494 |
| ChEBI | CHEBI:27869 |
| MDL Number | MFCD00002683 |
| SMILES | C(C(=O)O)Cl |
| Synonym | chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure |
| IUPAC Name | 2-chloroacetic acid |
| InChI Key | FOCAUTSVDIKZOP-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |
| CAS | 1338-24-5 |
|---|---|
| MDL Number | MFCD00147696 |
2,4-Dibromophenol, 98%
CAS: 615-58-7 Molecular Formula: C6H4Br2O Molecular Weight (g/mol): 251.905 MDL Number: MFCD00002149 InChI Key: FAXWFCTVSHEODL-UHFFFAOYSA-N Synonym: phenol, 2,4-dibromo,2,4-dibromo-phenol,2,4-dibromphenol,unii-ia75t5c9tg,2,4-bis bromanyl phenol,ia75t5c9tg,phenol,4-dibromo,emery 9331,acmc-1bga9,2,4-dibromophenol PubChem CID: 12005 ChEBI: CHEBI:34238 IUPAC Name: 2,4-dibromophenol SMILES: C1=CC(=C(C=C1Br)Br)O
| PubChem CID | 12005 |
|---|---|
| CAS | 615-58-7 |
| Molecular Weight (g/mol) | 251.905 |
| ChEBI | CHEBI:34238 |
| MDL Number | MFCD00002149 |
| SMILES | C1=CC(=C(C=C1Br)Br)O |
| Synonym | phenol, 2,4-dibromo,2,4-dibromo-phenol,2,4-dibromphenol,unii-ia75t5c9tg,2,4-bis bromanyl phenol,ia75t5c9tg,phenol,4-dibromo,emery 9331,acmc-1bga9,2,4-dibromophenol |
| IUPAC Name | 2,4-dibromophenol |
| InChI Key | FAXWFCTVSHEODL-UHFFFAOYSA-N |
| Molecular Formula | C6H4Br2O |
Croconic acid, 98%
CAS: 488-86-8 Molecular Formula: C5H2O5 Molecular Weight (g/mol): 142.066 MDL Number: MFCD00181389 InChI Key: RBSLJAJQOVYTRQ-UHFFFAOYSA-N Synonym: croconic acid,crocic acid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione,unii-6hgy35uxaa,6hgy35uxaa,4-cyclopentene-1,2,3-trione, 4,5-dihydroxy,croconicacid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione # PubChem CID: 546874 IUPAC Name: 4,5-dihydroxycyclopent-4-ene-1,2,3-trione SMILES: C1(=C(C(=O)C(=O)C1=O)O)O
| PubChem CID | 546874 |
|---|---|
| CAS | 488-86-8 |
| Molecular Weight (g/mol) | 142.066 |
| MDL Number | MFCD00181389 |
| SMILES | C1(=C(C(=O)C(=O)C1=O)O)O |
| Synonym | croconic acid,crocic acid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione,unii-6hgy35uxaa,6hgy35uxaa,4-cyclopentene-1,2,3-trione, 4,5-dihydroxy,croconicacid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione # |
| IUPAC Name | 4,5-dihydroxycyclopent-4-ene-1,2,3-trione |
| InChI Key | RBSLJAJQOVYTRQ-UHFFFAOYSA-N |
| Molecular Formula | C5H2O5 |
Syringic acid, 97%
CAS: 530-57-4 Molecular Formula: C9H10O5 Molecular Weight (g/mol): 198.17 MDL Number: MFCD00002552 InChI Key: JMSVCTWVEWCHDZ-UHFFFAOYSA-N Synonym: syringic acid,3,5-dimethoxy-4-hydroxybenzoic acid,cedar acid,gallic acid 3,5-dimethyl ether,benzoic acid, 4-hydroxy-3,5-dimethoxy,3,5-dimethoxy-4-hydroxybenzyl acid,4-hydroxy-3,5-dimethoxy-benzoic acid,chembl1414,syringicacid,syringlicacid PubChem CID: 10742 ChEBI: CHEBI:68329 IUPAC Name: 4-hydroxy-3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1O)C(O)=O
| PubChem CID | 10742 |
|---|---|
| CAS | 530-57-4 |
| Molecular Weight (g/mol) | 198.17 |
| ChEBI | CHEBI:68329 |
| MDL Number | MFCD00002552 |
| SMILES | COC1=CC(=CC(OC)=C1O)C(O)=O |
| Synonym | syringic acid,3,5-dimethoxy-4-hydroxybenzoic acid,cedar acid,gallic acid 3,5-dimethyl ether,benzoic acid, 4-hydroxy-3,5-dimethoxy,3,5-dimethoxy-4-hydroxybenzyl acid,4-hydroxy-3,5-dimethoxy-benzoic acid,chembl1414,syringicacid,syringlicacid |
| IUPAC Name | 4-hydroxy-3,5-dimethoxybenzoic acid |
| InChI Key | JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O5 |
1,3-Diacetylbenzene, 99%, Thermo Scientific Chemicals
CAS: 6781-42-6 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00008740 InChI Key: VCHOFVSNWYPAEF-UHFFFAOYSA-N Synonym: 1,3-diacetylbenzene,1,1'-1,3-phenylene diethanone,ethanone, 1,1'-1,3-phenylene bis,m-diacetylbenzene,benzene-1,3-bis acetyl,m-acetylacetophenone,m-acetyl acetophenone,1-3-acetylphenyl ethanone,1-3-acetylphenyl ethan-1-one,m-diacetyl benzene PubChem CID: 23229 IUPAC Name: 1-(3-acetylphenyl)ethanone SMILES: CC(=O)C1=CC(=CC=C1)C(C)=O
| PubChem CID | 23229 |
|---|---|
| CAS | 6781-42-6 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00008740 |
| SMILES | CC(=O)C1=CC(=CC=C1)C(C)=O |
| Synonym | 1,3-diacetylbenzene,1,1'-1,3-phenylene diethanone,ethanone, 1,1'-1,3-phenylene bis,m-diacetylbenzene,benzene-1,3-bis acetyl,m-acetylacetophenone,m-acetyl acetophenone,1-3-acetylphenyl ethanone,1-3-acetylphenyl ethan-1-one,m-diacetyl benzene |
| IUPAC Name | 1-(3-acetylphenyl)ethanone |
| InChI Key | VCHOFVSNWYPAEF-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |