Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Isopropyl acetate, 99+%
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.133 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
4-Chlorobenzotrifluoride, 98+%
CAS: 98-56-6 Molecular Formula: C7H4ClF3 Molecular Weight (g/mol): 180.554 MDL Number: MFCD00000627 InChI Key: QULYNCCPRWKEMF-UHFFFAOYSA-N Synonym: 4-chlorobenzotrifluoride,p-chlorobenzotrifluoride,1-chloro-4-trifluoromethyl benzene,benzene, 1-chloro-4-trifluoromethyl,4-chloro-alpha,alpha,alpha-trifluorotoluene,para-chlorobenzotrifluoride,p-chlorophenyl trifluoromethane,p-chloro-a,a,a-trifluorotoluene,pcbtf,p-chlorotrifluoromethylbenzene PubChem CID: 7394 IUPAC Name: 1-chloro-4-(trifluoromethyl)benzene SMILES: C1=CC(=CC=C1C(F)(F)F)Cl
| PubChem CID | 7394 |
|---|---|
| CAS | 98-56-6 |
| Molecular Weight (g/mol) | 180.554 |
| MDL Number | MFCD00000627 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)Cl |
| Synonym | 4-chlorobenzotrifluoride,p-chlorobenzotrifluoride,1-chloro-4-trifluoromethyl benzene,benzene, 1-chloro-4-trifluoromethyl,4-chloro-alpha,alpha,alpha-trifluorotoluene,para-chlorobenzotrifluoride,p-chlorophenyl trifluoromethane,p-chloro-a,a,a-trifluorotoluene,pcbtf,p-chlorotrifluoromethylbenzene |
| IUPAC Name | 1-chloro-4-(trifluoromethyl)benzene |
| InChI Key | QULYNCCPRWKEMF-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3 |
4,4'-Dimethoxytrityl Chloride, 98%
CAS: 40615-36-9 Molecular Formula: C21H19ClO2 Molecular Weight (g/mol): 338.83 MDL Number: MFCD00008409 InChI Key: JBWYRBLDOOOJEU-UHFFFAOYSA-N Synonym: 4,4'-dimethoxytrityl chloride,dmt-cl,4,4'-dimethoxytritylchloride,4,4'-chloro phenyl methylene bis methoxybenzene,4,4'-dimethoxytriphenylmethyl chloride,1,1'-chlorophenylmethylene bis 4-methoxybenzene,benzene, 1,1'-chlorophenylmethylene bis 4-methoxy,chloro-4,4'-dimethoxytriphenylmethane,1-chloro 4-methoxyphenyl phenylmethyl-4-methoxybenzene,4,4'-dimethoxytritylchloride dmt-cl PubChem CID: 96831 IUPAC Name: 1-[chloro-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene SMILES: COC1=CC=C(C=C1)C(Cl)(C1=CC=CC=C1)C1=CC=C(OC)C=C1
| PubChem CID | 96831 |
|---|---|
| CAS | 40615-36-9 |
| Molecular Weight (g/mol) | 338.83 |
| MDL Number | MFCD00008409 |
| SMILES | COC1=CC=C(C=C1)C(Cl)(C1=CC=CC=C1)C1=CC=C(OC)C=C1 |
| Synonym | 4,4'-dimethoxytrityl chloride,dmt-cl,4,4'-dimethoxytritylchloride,4,4'-chloro phenyl methylene bis methoxybenzene,4,4'-dimethoxytriphenylmethyl chloride,1,1'-chlorophenylmethylene bis 4-methoxybenzene,benzene, 1,1'-chlorophenylmethylene bis 4-methoxy,chloro-4,4'-dimethoxytriphenylmethane,1-chloro 4-methoxyphenyl phenylmethyl-4-methoxybenzene,4,4'-dimethoxytritylchloride dmt-cl |
| IUPAC Name | 1-[chloro-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene |
| InChI Key | JBWYRBLDOOOJEU-UHFFFAOYSA-N |
| Molecular Formula | C21H19ClO2 |
Gibberellic acid, 90+%
CAS: 77-06-5 Molecular Formula: C19H22O6 Molecular Weight (g/mol): 346.38 MDL Number: MFCD00079329 InChI Key: IXORZMNAPKEEDV-QTWFBFKQSA-N Synonym: gibberellic acid,gibberellin a3,gibberellin,gibreskol,brellin,cekugib,grocel,gibberellin x,gibberellic acid ga3,gib-tabs PubChem CID: 91757643 IUPAC Name: (1R,2R,5S,8S,9S,10R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1⁵,⁸.0¹,¹⁰.0²,⁸]heptadec-13-ene-9-carboxylic acid SMILES: CC12[C@H]3[C@H](C(O)=O)[C@@]45CC(=C)[C@@](O)(C4)CC[C@H]5[C@]3(OC1=O)C=C[C@@H]2O
| PubChem CID | 91757643 |
|---|---|
| CAS | 77-06-5 |
| Molecular Weight (g/mol) | 346.38 |
| MDL Number | MFCD00079329 |
| SMILES | CC12[C@H]3[C@H](C(O)=O)[C@@]45CC(=C)[C@@](O)(C4)CC[C@H]5[C@]3(OC1=O)C=C[C@@H]2O |
| Synonym | gibberellic acid,gibberellin a3,gibberellin,gibreskol,brellin,cekugib,grocel,gibberellin x,gibberellic acid ga3,gib-tabs |
| IUPAC Name | (1R,2R,5S,8S,9S,10R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1⁵,⁸.0¹,¹⁰.0²,⁸]heptadec-13-ene-9-carboxylic acid |
| InChI Key | IXORZMNAPKEEDV-QTWFBFKQSA-N |
| Molecular Formula | C19H22O6 |
3-Hydroxy-2-methyl-4-pyrone, 99%
CAS: 118-71-8 Molecular Formula: C6H6O3 Molecular Weight (g/mol): 126.11 MDL Number: MFCD00006578 InChI Key: XPCTZQVDEJYUGT-UHFFFAOYSA-N Synonym: maltol,3-hydroxy-2-methyl-4-pyrone,3-hydroxy-2-methyl-4h-pyran-4-one,larixinic acid,talmon,palatone,vetol,larixic acid,corps praline,4h-pyran-4-one, 3-hydroxy-2-methyl PubChem CID: 8369 ChEBI: CHEBI:69438 IUPAC Name: 3-hydroxy-2-methylpyran-4-one SMILES: CC1=C(O)C(=O)C=CO1
| PubChem CID | 8369 |
|---|---|
| CAS | 118-71-8 |
| Molecular Weight (g/mol) | 126.11 |
| ChEBI | CHEBI:69438 |
| MDL Number | MFCD00006578 |
| SMILES | CC1=C(O)C(=O)C=CO1 |
| Synonym | maltol,3-hydroxy-2-methyl-4-pyrone,3-hydroxy-2-methyl-4h-pyran-4-one,larixinic acid,talmon,palatone,vetol,larixic acid,corps praline,4h-pyran-4-one, 3-hydroxy-2-methyl |
| IUPAC Name | 3-hydroxy-2-methylpyran-4-one |
| InChI Key | XPCTZQVDEJYUGT-UHFFFAOYSA-N |
| Molecular Formula | C6H6O3 |
4-Hexyloxybenzaldehyde, 99%, Thermo Scientific™
CAS: 5736-94-7 Molecular Formula: C13H18O2 Molecular Weight (g/mol): 206.28 MDL Number: MFCD00016615 InChI Key: GWXUVWKBVROFDM-UHFFFAOYSA-N Synonym: 4-hexyloxy benzaldehyde,4-hexyloxybenzaldehyde,4-n-hexyloxybenzaldehyde,p-hexyloxybenzaldehyde,benzaldehyde, 4-hexyloxy,benzaldehyde, p-hexyloxy,p-hexyloxy benzaldehyde,p-hexoxybenzaldehyde,4-hexyloxbenzaldehyde,p-n-hexyloxybenzaldehyde PubChem CID: 79816 IUPAC Name: 4-hexoxybenzaldehyde SMILES: CCCCCCOC1=CC=C(C=C1)C=O
| PubChem CID | 79816 |
|---|---|
| CAS | 5736-94-7 |
| Molecular Weight (g/mol) | 206.28 |
| MDL Number | MFCD00016615 |
| SMILES | CCCCCCOC1=CC=C(C=C1)C=O |
| Synonym | 4-hexyloxy benzaldehyde,4-hexyloxybenzaldehyde,4-n-hexyloxybenzaldehyde,p-hexyloxybenzaldehyde,benzaldehyde, 4-hexyloxy,benzaldehyde, p-hexyloxy,p-hexyloxy benzaldehyde,p-hexoxybenzaldehyde,4-hexyloxbenzaldehyde,p-n-hexyloxybenzaldehyde |
| IUPAC Name | 4-hexoxybenzaldehyde |
| InChI Key | GWXUVWKBVROFDM-UHFFFAOYSA-N |
| Molecular Formula | C13H18O2 |
Lithium acetate dihydrate, MP Biomedicals™
CAS: 6108-17-4 Molecular Formula: C2H7LiO4 Molecular Weight (g/mol): 102.014 InChI Key: IAQLJCYTGRMXMA-UHFFFAOYSA-M Synonym: lithium acetate dihydrate,lithiumacetatedihydrate,lithium acetate dihydrate, reagent grade,lioac-2h2o,lioac.2h2o,ksc498a1d,c2h3o2.li.2h2o,lithotab acetate ion dihydrate,acetic acid lithium salt dihydrate PubChem CID: 23666338 IUPAC Name: lithium;acetate;dihydrate SMILES: [Li+].CC(=O)[O-].O.O
| PubChem CID | 23666338 |
|---|---|
| CAS | 6108-17-4 |
| Molecular Weight (g/mol) | 102.014 |
| SMILES | [Li+].CC(=O)[O-].O.O |
| Synonym | lithium acetate dihydrate,lithiumacetatedihydrate,lithium acetate dihydrate, reagent grade,lioac-2h2o,lioac.2h2o,ksc498a1d,c2h3o2.li.2h2o,lithotab acetate ion dihydrate,acetic acid lithium salt dihydrate |
| IUPAC Name | lithium;acetate;dihydrate |
| InChI Key | IAQLJCYTGRMXMA-UHFFFAOYSA-M |
| Molecular Formula | C2H7LiO4 |
Glutaric dialdehyde, electron microscopy grade, 25% solution in water, purified
CAS: 111-30-8 | C5H8O2 | 100.12 g/mol
| Linear Formula | OHC(CH2)3CHO |
|---|---|
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:64276 |
| InChI Key | SXRSQZLOMIGNAQ-UHFFFAOYSA-N |
| Density | 1.0600g/mL |
| PubChem CID | 3485 |
| Name Note | Purified |
| Percent Purity | 25 to 27 wt% |
| Fieser | 01,411 |
| pH | 3.1 to 4.5 (25°C) |
| Formula Weight | 100.12 |
| Melting Point | -5.0°C |
| Boiling Point | 101°C |
| Physical Form | Solution |
| Chemical Name or Material | Glutaric dialdehyde, electron microscopy grade |
| Grade | E.M. |
| SMILES | O=CCCCC=O |
| Merck Index | 15, 4508 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER |
| MDL Number | MFCD00007025 |
| Health Hazard 2 | GHS H Statement May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. Causes severe skin burns and eye damage. Harmful if swallowed. Harmful if inhaled. Very t |
| Solubility Information | Solubility in water: soluble |
| Packaging | Glass bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.373 |
| Synonym | glutaraldehyde,glutaral,glutaric dialdehyde,cidex,glutardialdehyde,1,5-pentanedial,sonacide,glutarol,aldesan,glutaric aldehyde |
| IUPAC Name | pentanedial |
| Beilstein | 01, 776 |
| Molecular Formula | C5H8O2 |
| EINECS Number | 203-856-5 |
| Specific Gravity | 1.06 |
3-Nitrophenylboronic acid, 97%
CAS: 13331-27-6 Molecular Formula: C6H6BNO4 Molecular Weight (g/mol): 166.93 MDL Number: MFCD00007193 InChI Key: ZNRGSYUVFVNSAW-UHFFFAOYSA-N Synonym: 3-nitrophenyl boronic acid,3-nitrobenzeneboronic acid,m-nitrophenylboronic acid,boronic acid, 3-nitrophenyl,m-nitrobenzeneboronic acid,benzeneboronic acid, m-nitro,nitrophenylboronic acid,m-nitophenyl boronic acid,3-nitrophenyl boranediol PubChem CID: 1677 IUPAC Name: (3-nitrophenyl)boronic acid SMILES: OB(O)C1=CC=CC(=C1)[N+]([O-])=O
| PubChem CID | 1677 |
|---|---|
| CAS | 13331-27-6 |
| Molecular Weight (g/mol) | 166.93 |
| MDL Number | MFCD00007193 |
| SMILES | OB(O)C1=CC=CC(=C1)[N+]([O-])=O |
| Synonym | 3-nitrophenyl boronic acid,3-nitrobenzeneboronic acid,m-nitrophenylboronic acid,boronic acid, 3-nitrophenyl,m-nitrobenzeneboronic acid,benzeneboronic acid, m-nitro,nitrophenylboronic acid,m-nitophenyl boronic acid,3-nitrophenyl boranediol |
| IUPAC Name | (3-nitrophenyl)boronic acid |
| InChI Key | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| Molecular Formula | C6H6BNO4 |
1,6-Diphenyl-1,3,5-hexatriene, 95%
CAS: 1720-32-7 Molecular Formula: C18H16 Molecular Weight (g/mol): 232.32 MDL Number: MFCD00004793 InChI Key: BOBLSBAZCVBABY-WPWUJOAOSA-N Synonym: 1,6-diphenyl-1,3,5-hexatriene,1,6-diphenylhexatriene,diphenylhexatriene,dicinnamyl,1,6-diphenylhexa-1,3,5-triene,benzene, 1,1'-1,3,5-hexatriene-1,6-diyl bis,1,3,5-hexatriene, 1,6-diphenyl,1e,3e,5e-6-phenylhexa-1,3,5-trienyl benzene,1,1'-1e,3e,5e-hexa-1,3,5-triene-1,6-diyldibenzene PubChem CID: 5376733 ChEBI: CHEBI:51594 IUPAC Name: [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene SMILES: C1=CC=C(C=C1)C=CC=CC=CC2=CC=CC=C2
| PubChem CID | 5376733 |
|---|---|
| CAS | 1720-32-7 |
| Molecular Weight (g/mol) | 232.32 |
| ChEBI | CHEBI:51594 |
| MDL Number | MFCD00004793 |
| SMILES | C1=CC=C(C=C1)C=CC=CC=CC2=CC=CC=C2 |
| Synonym | 1,6-diphenyl-1,3,5-hexatriene,1,6-diphenylhexatriene,diphenylhexatriene,dicinnamyl,1,6-diphenylhexa-1,3,5-triene,benzene, 1,1'-1,3,5-hexatriene-1,6-diyl bis,1,3,5-hexatriene, 1,6-diphenyl,1e,3e,5e-6-phenylhexa-1,3,5-trienyl benzene,1,1'-1e,3e,5e-hexa-1,3,5-triene-1,6-diyldibenzene |
| IUPAC Name | [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
| InChI Key | BOBLSBAZCVBABY-WPWUJOAOSA-N |
| Molecular Formula | C18H16 |
2-Methoxyphenylboronic acid, 97%
CAS: 5720-06-9 Molecular Formula: C7H9BO3 Molecular Weight (g/mol): 151.96 MDL Number: MFCD00236047 InChI Key: ROEQGIFOWRQYHD-UHFFFAOYSA-N SMILES: COC1=CC=CC=C1B(O)O
| CAS | 5720-06-9 |
|---|---|
| Molecular Weight (g/mol) | 151.96 |
| MDL Number | MFCD00236047 |
| SMILES | COC1=CC=CC=C1B(O)O |
| InChI Key | ROEQGIFOWRQYHD-UHFFFAOYSA-N |
| Molecular Formula | C7H9BO3 |
4-Hydroxy-4-methyl-2-pentanone, 99%
CAS: 123-42-2 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00004471 InChI Key: SWXVUIWOUIDPGS-UHFFFAOYSA-N Synonym: diacetone alcohol,4-hydroxy-4-methyl-2-pentanone,diacetonalkohol,diketone alcohol,diacetonalcohol,tyranton,acetonyldimethylcarbinol,diacetone-alcool,pyranton a,2-methyl-2-pentanol-4-one PubChem CID: 31256 ChEBI: CHEBI:55381 IUPAC Name: 4-hydroxy-4-methylpentan-2-one SMILES: CC(=O)CC(C)(C)O
| PubChem CID | 31256 |
|---|---|
| CAS | 123-42-2 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:55381 |
| MDL Number | MFCD00004471 |
| SMILES | CC(=O)CC(C)(C)O |
| Synonym | diacetone alcohol,4-hydroxy-4-methyl-2-pentanone,diacetonalkohol,diketone alcohol,diacetonalcohol,tyranton,acetonyldimethylcarbinol,diacetone-alcool,pyranton a,2-methyl-2-pentanol-4-one |
| IUPAC Name | 4-hydroxy-4-methylpentan-2-one |
| InChI Key | SWXVUIWOUIDPGS-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
2-Heptylamine, 98+%
CAS: 123-82-0 Molecular Formula: C7H17N Molecular Weight (g/mol): 115.22 MDL Number: MFCD00008101 InChI Key: VSRBKQFNFZQRBM-UHFFFAOYNA-N Synonym: 2-aminoheptane,tuaminoheptane,2-heptylamine,2-heptanamine,heptamine,1-methylhexylamine,heptin,tuamine,tuaminoheptan,rineptil PubChem CID: 5603 IUPAC Name: heptan-2-amine SMILES: CCCCCC(C)N
| PubChem CID | 5603 |
|---|---|
| CAS | 123-82-0 |
| Molecular Weight (g/mol) | 115.22 |
| MDL Number | MFCD00008101 |
| SMILES | CCCCCC(C)N |
| Synonym | 2-aminoheptane,tuaminoheptane,2-heptylamine,2-heptanamine,heptamine,1-methylhexylamine,heptin,tuamine,tuaminoheptan,rineptil |
| IUPAC Name | heptan-2-amine |
| InChI Key | VSRBKQFNFZQRBM-UHFFFAOYNA-N |
| Molecular Formula | C7H17N |
trans-4-Hydroxy-3-methoxycinnamic acid, 99%
CAS: 537-98-4 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00004400 InChI Key: KSEBMYQBYZTDHS-HWKANZROSA-N Synonym: ferulic acid,trans-ferulic acid,4-hydroxy-3-methoxycinnamic acid,trans-4-hydroxy-3-methoxycinnamic acid,3-4-hydroxy-3-methoxyphenyl acrylic acid,e-ferulic acid,coniferic acid,ferulate,ferulic acid, trans,2-propenoic acid, 3-4-hydroxy-3-methoxyphenyl PubChem CID: 445858 ChEBI: CHEBI:17620 IUPAC Name: (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid SMILES: COC1=CC(\C=C\C(O)=O)=CC=C1O
| PubChem CID | 445858 |
|---|---|
| CAS | 537-98-4 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:17620 |
| MDL Number | MFCD00004400 |
| SMILES | COC1=CC(\C=C\C(O)=O)=CC=C1O |
| Synonym | ferulic acid,trans-ferulic acid,4-hydroxy-3-methoxycinnamic acid,trans-4-hydroxy-3-methoxycinnamic acid,3-4-hydroxy-3-methoxyphenyl acrylic acid,e-ferulic acid,coniferic acid,ferulate,ferulic acid, trans,2-propenoic acid, 3-4-hydroxy-3-methoxyphenyl |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| InChI Key | KSEBMYQBYZTDHS-HWKANZROSA-N |
| Molecular Formula | C10H10O4 |
Chloranilic acid, 98+%
CAS: 87-88-7 Molecular Formula: C6H2Cl2O4 Molecular Weight (g/mol): 208.978 MDL Number: MFCD00001596 InChI Key: IPPWILKGXFOXHO-UHFFFAOYSA-N Synonym: chloranilic acid,2,5-dichloro-3,6-dihydroxy-p-benzoquinone,p-chloranilic acid,2,5-cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy,unii-yj8l3bb7y4,2,5-dichloro-3,6-dihydroxybenzoquinone,2,5-dihydroxy-3,6-dichlorobenzoquinone,yj8l3bb7y4,p-quinone, 2,5-dichloro-3,6-dihydroxy,p-benzoquinone, 2,5-dichloro-3,6-dihydroxy PubChem CID: 66604 IUPAC Name: 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione SMILES: C1(=C(C(=O)C(=C(C1=O)Cl)O)Cl)O
| PubChem CID | 66604 |
|---|---|
| CAS | 87-88-7 |
| Molecular Weight (g/mol) | 208.978 |
| MDL Number | MFCD00001596 |
| SMILES | C1(=C(C(=O)C(=C(C1=O)Cl)O)Cl)O |
| Synonym | chloranilic acid,2,5-dichloro-3,6-dihydroxy-p-benzoquinone,p-chloranilic acid,2,5-cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy,unii-yj8l3bb7y4,2,5-dichloro-3,6-dihydroxybenzoquinone,2,5-dihydroxy-3,6-dichlorobenzoquinone,yj8l3bb7y4,p-quinone, 2,5-dichloro-3,6-dihydroxy,p-benzoquinone, 2,5-dichloro-3,6-dihydroxy |
| IUPAC Name | 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione |
| InChI Key | IPPWILKGXFOXHO-UHFFFAOYSA-N |
| Molecular Formula | C6H2Cl2O4 |